C32H39N8O4+ — CID 100961413
methyl 5-(diaminomethylideneamino)-2-[[4-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]-2-oxobutyl]amino]pentanoate (PubChem CID 100961413) has the molecular formula C32H39N8O4+ and a molecular weight of 599.72 g/mol. Its IUPAC name is methyl 5-(diaminomethylideneamino)-2-[[4-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]-2-oxobutyl]amino]pentanoate.
| Compound Name | methyl 5-(diaminomethylideneamino)-2-[[4-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]-2-oxobutyl]amino]pentanoate |
|---|---|
| PubChem CID | 100961413 |
| Molecular Formula | C32H39N8O4+ |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | methyl 5-(diaminomethylideneamino)-2-[[4-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]-2-oxobutyl]amino]pentanoate |
| SMILES | COC(=O)C(CCCN=C(N)N)NCC(=O)CCNC(=O)c1cccc(-c2c3cc(N)ccc3c3ccc(N)cc3[n+]2C)c1 |
| InChI | InChI=1S/C32H38N8O4/c1-40-28-17-22(34)9-11-25(28)24-10-8-21(33)16-26(24)29(40)19-5-3-6-20(15-19)30(42)37-14-12-23(41)18-39-27(31(43)44-2)7-4-13-38-32(35)36/h3,5-6,8-11,15-17,27,34,39H,4,7,12-14,18,33H2,1-2H3,(H5,35,36,37,38,42)/p+1 |
| InChIKey | TUWFDMNQWKZJQP-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 204.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|