C31H37N8O4+ — CID 10841580
methyl 5-(diaminomethylideneamino)-2-[3-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]propanoylamino]pentanoate (PubChem CID 10841580) has the molecular formula C31H37N8O4+ and a molecular weight of 585.69 g/mol. Its IUPAC name is methyl 5-(diaminomethylideneamino)-2-[3-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]propanoylamino]pentanoate.
| Compound Name | methyl 5-(diaminomethylideneamino)-2-[3-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]propanoylamino]pentanoate |
|---|---|
| PubChem CID | 10841580 |
| Molecular Formula | C31H37N8O4+ |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | methyl 5-(diaminomethylideneamino)-2-[3-[[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)benzoyl]amino]propanoylamino]pentanoate |
| SMILES | COC(=O)C(CCCN=C(N)N)NC(=O)CCNC(=O)c1cccc(-c2c3cc(N)ccc3c3ccc(N)cc3[n+]2C)c1 |
| InChI | InChI=1S/C31H36N8O4/c1-39-26-17-21(33)9-11-23(26)22-10-8-20(32)16-24(22)28(39)18-5-3-6-19(15-18)29(41)36-14-12-27(40)38-25(30(42)43-2)7-4-13-37-31(34)35/h3,5-6,8-11,15-17,25,33H,4,7,12-14,32H2,1-2H3,(H6,34,35,36,37,38,40,41)/p+1 |
| InChIKey | OOVXSMPJUZAOPD-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 204.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|