C20H17ClN4O2 — CID 24841214
5-methyl-6-(4-nitrophenyl)phenanthridin-5-ium-3,8-diamine chloride (PubChem CID 24841214) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is 5-methyl-6-(4-nitrophenyl)phenanthridin-5-ium-3,8-diamine chloride.
| Compound Name | 5-methyl-6-(4-nitrophenyl)phenanthridin-5-ium-3,8-diamine chloride |
|---|---|
| PubChem CID | 24841214 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 5-methyl-6-(4-nitrophenyl)phenanthridin-5-ium-3,8-diamine chloride |
| SMILES | C[n+]1c(-c2ccc([N+](=O)[O-])cc2)c2cc(N)ccc2c2ccc(N)cc21.[Cl-] |
| InChI | InChI=1S/C20H16N4O2.ClH/c1-23-19-11-14(22)5-9-17(19)16-8-4-13(21)10-18(16)20(23)12-2-6-15(7-3-12)24(25)26;/h2-11,22H,21H2,1H3;1H |
| InChIKey | ONTRXDNUPMXQPB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|