C41H43N6O2+ — CID 102251015
5-[(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-9-yl)amino]-N-[4-[2-(4-methyl-2-pyridinyl)pyridin-1-ium-4-yl]butyl]-5-oxopentanimidate (PubChem CID 102251015) has the molecular formula C41H43N6O2+ and a molecular weight of 651.84 g/mol. Its IUPAC name is 5-[(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-9-yl)amino]-N-[4-[2-(4-methyl-2-pyridinyl)pyridin-1-ium-4-yl]butyl]-5-oxopentanimidate.
| Compound Name | 5-[(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-9-yl)amino]-N-[4-[2-(4-methyl-2-pyridinyl)pyridin-1-ium-4-yl]butyl]-5-oxopentanimidate |
|---|---|
| PubChem CID | 102251015 |
| Molecular Formula | C41H43N6O2+ |
| Molecular Weight | 651.84 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 5-[(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-9-yl)amino]-N-[4-[2-(4-methyl-2-pyridinyl)pyridin-1-ium-4-yl]butyl]-5-oxopentanimidate |
| SMILES | CC[n+]1c(-c2ccccc2)c2ccc(NC(=O)CCC/C([O-])=N/CCCCc3cc[nH+]c(-c4cc(C)ccn4)c3)cc2c2ccc(N)cc21 |
| InChI | InChI=1S/C41H42N6O2/c1-3-47-38-26-31(42)15-17-33(38)35-27-32(16-18-34(35)41(47)30-11-5-4-6-12-30)46-40(49)14-9-13-39(48)45-21-8-7-10-29-20-23-44-37(25-29)36-24-28(2)19-22-43-36/h4-6,11-12,15-20,22-27H,3,7-10,13-14,21H2,1-2H3,(H3,42,45,46,48,49)/p+1 |
| InChIKey | WCWOTBUTTZVYOF-UHFFFAOYSA-O |
| XLogP | 6.62 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.84 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|