C24H23N3O — CID 121028737
N-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-phenylbutanamide (PubChem CID 121028737) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-phenylbutanamide.
| Compound Name | N-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 121028737 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-phenylbutanamide |
| SMILES | Cc1ccn2cc(-c3ccc(NC(=O)CCCc4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C24H23N3O/c1-18-14-15-27-17-22(26-23(27)16-18)20-10-12-21(13-11-20)25-24(28)9-5-8-19-6-3-2-4-7-19/h2-4,6-7,10-17H,5,8-9H2,1H3,(H,25,28) |
| InChIKey | JGASKSGKTJSKDG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |