C20H19N3O4 — CID 168570718
dimethyl (E)-2-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]but-2-enedioate (PubChem CID 168570718) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570718 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | dimethyl (E)-2-[4-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(-c2cn3ccc(C)cc3n2)cc1)C(=O)OC |
| InChI | InChI=1S/C20H19N3O4/c1-13-8-9-23-12-17(22-18(23)10-13)14-4-6-15(7-5-14)21-16(20(25)27-3)11-19(24)26-2/h4-12,21H,1-3H3/b16-11+ |
| InChIKey | NJUGDLFQCLJCPR-LFIBNONCSA-N |
| XLogP | 2.95 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|