C14H20N4O3 — CID 131994630
5-(diaminomethylideneamino)-N-(3-formyl-4-methoxyphenyl)pentanamide (PubChem CID 131994630) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-N-(3-formyl-4-methoxyphenyl)pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-N-(3-formyl-4-methoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 131994630 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 5-(diaminomethylideneamino)-N-(3-formyl-4-methoxyphenyl)pentanamide |
| SMILES | COc1ccc(NC(=O)CCCCN=C(N)N)cc1C=O |
| InChI | InChI=1S/C14H20N4O3/c1-21-12-6-5-11(8-10(12)9-19)18-13(20)4-2-3-7-17-14(15)16/h5-6,8-9H,2-4,7H2,1H3,(H,18,20)(H4,15,16,17) |
| InChIKey | LHAXHNJXUYOJRS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|