C31H31BrN4O3 — CID 161321437
N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)-6-(2,5-dioxopyrrol-1-yl)hexanamide bromide (PubChem CID 161321437) has the molecular formula C31H31BrN4O3 and a molecular weight of 587.52 g/mol. Its IUPAC name is N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)-6-(2,5-dioxopyrrol-1-yl)hexanamide bromide.
| Compound Name | N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)-6-(2,5-dioxopyrrol-1-yl)hexanamide bromide |
|---|---|
| PubChem CID | 161321437 |
| Molecular Formula | C31H31BrN4O3 |
| Molecular Weight | 587.52 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | N-(3-amino-5-ethyl-6-phenylphenanthridin-5-ium-8-yl)-6-(2,5-dioxopyrrol-1-yl)hexanamide bromide |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(NC(=O)CCCCCN3C(=O)C=CC3=O)ccc2c2ccc(N)cc21.[Br-] |
| InChI | InChI=1S/C31H30N4O3.BrH/c1-2-34-27-19-22(32)12-14-25(27)24-15-13-23(20-26(24)31(34)21-9-5-3-6-10-21)33-28(36)11-7-4-8-18-35-29(37)16-17-30(35)38;/h3,5-6,9-10,12-17,19-20,32H,2,4,7-8,11,18H2,1H3,(H,33,36);1H |
| InChIKey | SRZDPZNAICILFO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|