C32H46Cl2N5O+ — CID 23758584
N-(2-aminoethyl)-6-[5,6-dichloro-2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-3-methylbenzimidazol-3-ium-1-yl]hexanamide (PubChem CID 23758584) has the molecular formula C32H46Cl2N5O+ and a molecular weight of 587.66 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[5,6-dichloro-2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-3-methylbenzimidazol-3-ium-1-yl]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[5,6-dichloro-2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-3-methylbenzimidazol-3-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 23758584 |
| Molecular Formula | C32H46Cl2N5O+ |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | N-(2-aminoethyl)-6-[5,6-dichloro-2-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-3-methylbenzimidazol-3-ium-1-yl]hexanamide |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2n(CCCCCC(=O)NCCN)c3cc(Cl)c(Cl)cc3[n+]2C)cc1 |
| InChI | InChI=1S/C32H45Cl2N5O/c1-4-6-20-38(21-7-5-2)26-15-12-25(13-16-26)14-17-32-37(3)29-23-27(33)28(34)24-30(29)39(32)22-10-8-9-11-31(40)36-19-18-35/h12-17,23-24H,4-11,18-22,35H2,1-3H3/p+1 |
| InChIKey | VGBYMIDCLQDVON-UHFFFAOYSA-O |
| XLogP | 6.98 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|