C31H45N2O4S2+ — CID 123892319
1,5-bis(sulfanyl)pentan-3-yl 4-[2-[2-[4-[bis(2-hydroxyethyl)amino]cyclohexa-1,3-dien-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butanoate (PubChem CID 123892319) has the molecular formula C31H45N2O4S2+ and a molecular weight of 573.85 g/mol. Its IUPAC name is 1,5-bis(sulfanyl)pentan-3-yl 4-[2-[2-[4-[bis(2-hydroxyethyl)amino]cyclohexa-1,3-dien-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butanoate.
| Compound Name | 1,5-bis(sulfanyl)pentan-3-yl 4-[2-[2-[4-[bis(2-hydroxyethyl)amino]cyclohexa-1,3-dien-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butanoate |
|---|---|
| PubChem CID | 123892319 |
| Molecular Formula | C31H45N2O4S2+ |
| Molecular Weight | 573.85 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 1,5-bis(sulfanyl)pentan-3-yl 4-[2-[2-[4-[bis(2-hydroxyethyl)amino]cyclohexa-1,3-dien-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butanoate |
| SMILES | CC1(C)C(C=CC2=CC=C(N(CCO)CCO)CC2)=[N+](CCCC(=O)OC(CCS)CCS)c2ccccc21 |
| InChI | InChI=1S/C31H44N2O4S2/c1-31(2)27-6-3-4-7-28(27)33(17-5-8-30(36)37-26(15-22-38)16-23-39)29(31)14-11-24-9-12-25(13-10-24)32(18-20-34)19-21-35/h3-4,6-7,9,11-12,14,26,34-35H,5,8,10,13,15-23H2,1-2H3,(H-,38,39)/p+1 |
| InChIKey | JPFAHXDPZKSRQL-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 73.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|