C25H31N2OS+ — CID 89017941
3-[(E)-2-[3,3-dimethyl-1-(4-sulfanylbutyl)indol-1-ium-2-yl]ethenyl]-1-methyl-2,3-dihydroindol-5-ol (PubChem CID 89017941) has the molecular formula C25H31N2OS+ and a molecular weight of 407.60 g/mol. Its IUPAC name is 3-[(E)-2-[3,3-dimethyl-1-(4-sulfanylbutyl)indol-1-ium-2-yl]ethenyl]-1-methyl-2,3-dihydroindol-5-ol.
| Compound Name | 3-[(E)-2-[3,3-dimethyl-1-(4-sulfanylbutyl)indol-1-ium-2-yl]ethenyl]-1-methyl-2,3-dihydroindol-5-ol |
|---|---|
| PubChem CID | 89017941 |
| Molecular Formula | C25H31N2OS+ |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[(E)-2-[3,3-dimethyl-1-(4-sulfanylbutyl)indol-1-ium-2-yl]ethenyl]-1-methyl-2,3-dihydroindol-5-ol |
| SMILES | CN1CC(/C=C/C2=[N+](CCCCS)c3ccccc3C2(C)C)c2cc(O)ccc21 |
| InChI | InChI=1S/C25H30N2OS/c1-25(2)21-8-4-5-9-23(21)27(14-6-7-15-29)24(25)13-10-18-17-26(3)22-12-11-19(28)16-20(18)22/h4-5,8-13,16,18H,6-7,14-15,17H2,1-3H3,(H-,28,29)/p+1/b13-10+ |
| InChIKey | AMGWLEFECVBIIJ-JLHYYAGUSA-O |
| XLogP | 5.27 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|