C24H31N2O2+ — CID 59035398
ethyl 6-(2,3,3-trimethyl-5-phenylpyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoate (PubChem CID 59035398) has the molecular formula C24H31N2O2+ and a molecular weight of 379.52 g/mol. Its IUPAC name is ethyl 6-(2,3,3-trimethyl-5-phenylpyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoate.
| Compound Name | ethyl 6-(2,3,3-trimethyl-5-phenylpyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoate |
|---|---|
| PubChem CID | 59035398 |
| Molecular Formula | C24H31N2O2+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | ethyl 6-(2,3,3-trimethyl-5-phenylpyrrolo[2,3-b]pyridin-7-ium-7-yl)hexanoate |
| SMILES | CCOC(=O)CCCCC[n+]1cc(-c2ccccc2)cc2c1N=C(C)C2(C)C |
| InChI | InChI=1S/C24H31N2O2/c1-5-28-22(27)14-10-7-11-15-26-17-20(19-12-8-6-9-13-19)16-21-23(26)25-18(2)24(21,3)4/h6,8-9,12-13,16-17H,5,7,10-11,14-15H2,1-4H3/q+1 |
| InChIKey | PCMWNVOPORDDLR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|