C38H47N2O5S+ — CID 166490825
4-[1-(4-ethoxy-4-oxobutyl)-5,5,7,8-tetramethyl-6-[(1E,3E)-4-(N-propan-2-ylanilino)buta-1,3-dienyl]-8H-quinolin-1-ium-3-yl]benzenesulfonic acid (PubChem CID 166490825) has the molecular formula C38H47N2O5S+ and a molecular weight of 643.87 g/mol. Its IUPAC name is 4-[1-(4-ethoxy-4-oxobutyl)-5,5,7,8-tetramethyl-6-[(1E,3E)-4-(N-propan-2-ylanilino)buta-1,3-dienyl]-8H-quinolin-1-ium-3-yl]benzenesulfonic acid.
| Compound Name | 4-[1-(4-ethoxy-4-oxobutyl)-5,5,7,8-tetramethyl-6-[(1E,3E)-4-(N-propan-2-ylanilino)buta-1,3-dienyl]-8H-quinolin-1-ium-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 166490825 |
| Molecular Formula | C38H47N2O5S+ |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 4-[1-(4-ethoxy-4-oxobutyl)-5,5,7,8-tetramethyl-6-[(1E,3E)-4-(N-propan-2-ylanilino)buta-1,3-dienyl]-8H-quinolin-1-ium-3-yl]benzenesulfonic acid |
| SMILES | CCOC(=O)CCC[n+]1cc(-c2ccc(S(=O)(=O)O)cc2)cc2c1C(C)C(C)=C(/C=C/C=C/N(c1ccccc1)C(C)C)C2(C)C |
| InChI | InChI=1S/C38H46N2O5S/c1-8-45-36(41)18-14-23-39-26-31(30-19-21-33(22-20-30)46(42,43)44)25-35-37(39)29(5)28(4)34(38(35,6)7)17-12-13-24-40(27(2)3)32-15-10-9-11-16-32/h9-13,15-17,19-22,24-27,29H,8,14,18,23H2,1-7H3/p+1/b17-12+,24-13+ |
| InChIKey | AVWNOHCIWUSEPM-CMTUKCOLSA-O |
| XLogP | 7.93 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|