C18H29N2O5S+ — CID 139945209
7-(6-ethoxy-6-oxohexyl)-2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-5-sulfonic acid (PubChem CID 139945209) has the molecular formula C18H29N2O5S+ and a molecular weight of 385.51 g/mol. Its IUPAC name is 7-(6-ethoxy-6-oxohexyl)-2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-5-sulfonic acid.
| Compound Name | 7-(6-ethoxy-6-oxohexyl)-2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 139945209 |
| Molecular Formula | C18H29N2O5S+ |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 7-(6-ethoxy-6-oxohexyl)-2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-5-sulfonic acid |
| SMILES | CCOC(=O)CCCCC[n+]1cc(S(=O)(=O)O)cc2c1NC(C)C2(C)C |
| InChI | InChI=1S/C18H28N2O5S/c1-5-25-16(21)9-7-6-8-10-20-12-14(26(22,23)24)11-15-17(20)19-13(2)18(15,3)4/h11-13H,5-10H2,1-4H3,(H,22,23,24)/p+1 |
| InChIKey | VGLYZBYOWQIQFM-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|