C18H27NO5S — CID 166692459
7-[(2,3,3-trimethyl-1,2-dihydroindol-5-yl)sulfonyloxy]heptanoic acid (PubChem CID 166692459) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is 7-[(2,3,3-trimethyl-1,2-dihydroindol-5-yl)sulfonyloxy]heptanoic acid.
| Compound Name | 7-[(2,3,3-trimethyl-1,2-dihydroindol-5-yl)sulfonyloxy]heptanoic acid |
|---|---|
| PubChem CID | 166692459 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 7-[(2,3,3-trimethyl-1,2-dihydroindol-5-yl)sulfonyloxy]heptanoic acid |
| SMILES | CC1Nc2ccc(S(=O)(=O)OCCCCCCC(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C18H27NO5S/c1-13-18(2,3)15-12-14(9-10-16(15)19-13)25(22,23)24-11-7-5-4-6-8-17(20)21/h9-10,12-13,19H,4-8,11H2,1-3H3,(H,20,21) |
| InChIKey | QFMCMOJNZQSZNF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|