C18H28O9S — CID 168842473
5-[2-[2-[2-(4-methylphenyl)sulfonylperoxyethoxy]ethoxy]ethoxy]pentanoic acid (PubChem CID 168842473) has the molecular formula C18H28O9S and a molecular weight of 420.48 g/mol. Its IUPAC name is 5-[2-[2-[2-(4-methylphenyl)sulfonylperoxyethoxy]ethoxy]ethoxy]pentanoic acid.
| Compound Name | 5-[2-[2-[2-(4-methylphenyl)sulfonylperoxyethoxy]ethoxy]ethoxy]pentanoic acid |
|---|---|
| PubChem CID | 168842473 |
| Molecular Formula | C18H28O9S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-[2-[2-[2-(4-methylphenyl)sulfonylperoxyethoxy]ethoxy]ethoxy]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OOCCOCCOCCOCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C18H28O9S/c1-16-5-7-17(8-6-16)28(21,22)27-26-15-14-25-13-12-24-11-10-23-9-3-2-4-18(19)20/h5-8H,2-4,9-15H2,1H3,(H,19,20) |
| InChIKey | CSUIIXJNKSHLRR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|