C18H24NO2+ — CID 20641163
2'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-5'-carboxylic acid (PubChem CID 20641163) has the molecular formula C18H24NO2+ and a molecular weight of 286.39 g/mol. Its IUPAC name is 2'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-5'-carboxylic acid.
| Compound Name | 2'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-5'-carboxylic acid |
|---|---|
| PubChem CID | 20641163 |
| Molecular Formula | C18H24NO2+ |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-5'-carboxylic acid |
| SMILES | CCC[N+]1=C(C)C2(CCCCC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C18H23NO2/c1-3-11-19-13(2)18(9-5-4-6-10-18)15-12-14(17(20)21)7-8-16(15)19/h7-8,12H,3-6,9-11H2,1-2H3/p+1 |
| InChIKey | HCQHLIVDVSXXKU-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|