C18H17F9NO2+ — CID 162536009
2,3,3-trimethyl-1-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)indol-1-ium-5-carboxylic acid (PubChem CID 162536009) has the molecular formula C18H17F9NO2+ and a molecular weight of 450.32 g/mol. Its IUPAC name is 2,3,3-trimethyl-1-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)indol-1-ium-5-carboxylic acid.
| Compound Name | 2,3,3-trimethyl-1-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)indol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 162536009 |
| Molecular Formula | C18H17F9NO2+ |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2,3,3-trimethyl-1-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)indol-1-ium-5-carboxylic acid |
| SMILES | CC1=[N+](C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F)c2ccc(C(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C18H16F9NO2/c1-9-14(2,3)11-8-10(13(29)30)4-5-12(11)28(9)18(26,27)17(24,25)15(19,20)6-7-16(21,22)23/h4-5,8H,6-7H2,1-3H3/p+1 |
| InChIKey | VPJKFABWFVJHJO-UHFFFAOYSA-O |
| XLogP | 5.99 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|