C11H12F3NO2 — CID 63227444
3-methyl-4-(3,3,3-trifluoropropylamino)benzoic acid (PubChem CID 63227444) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 3-methyl-4-(3,3,3-trifluoropropylamino)benzoic acid.
| Compound Name | 3-methyl-4-(3,3,3-trifluoropropylamino)benzoic acid |
|---|---|
| PubChem CID | 63227444 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-methyl-4-(3,3,3-trifluoropropylamino)benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NCCC(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2/c1-7-6-8(10(16)17)2-3-9(7)15-5-4-11(12,13)14/h2-3,6,15H,4-5H2,1H3,(H,16,17) |
| InChIKey | AEUURGXWRMHCRN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |