C14H21NO3 — CID 106148767
4-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbenzoic acid (PubChem CID 106148767) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbenzoic acid.
| Compound Name | 4-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 106148767 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 4-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NCC(C)(C)CCO |
| InChI | InChI=1S/C14H21NO3/c1-10-8-11(13(17)18)4-5-12(10)15-9-14(2,3)6-7-16/h4-5,8,15-16H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | SZNSJTXGRWSKJO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |