C15H18O4 — CID 67914061
2-(1-tert-butylcyclopropyl)terephthalic acid (PubChem CID 67914061) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(1-tert-butylcyclopropyl)terephthalic acid.
| Compound Name | 2-(1-tert-butylcyclopropyl)terephthalic acid |
|---|---|
| PubChem CID | 67914061 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(1-tert-butylcyclopropyl)terephthalic acid |
| SMILES | CC(C)(C)C1(c2cc(C(=O)O)ccc2C(=O)O)CC1 |
| InChI | InChI=1S/C15H18O4/c1-14(2,3)15(6-7-15)11-8-9(12(16)17)4-5-10(11)13(18)19/h4-5,8H,6-7H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | BPDDDGDCLTUNJY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |