C12H15NO2 — CID 105457500
2-(dimethylamino)-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 105457500) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(dimethylamino)-2,3-dihydro-1H-indene-5-carboxylic acid.
| Compound Name | 2-(dimethylamino)-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 105457500 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(dimethylamino)-2,3-dihydro-1H-indene-5-carboxylic acid |
| SMILES | CN(C)C1Cc2ccc(C(=O)O)cc2C1 |
| InChI | InChI=1S/C12H15NO2/c1-13(2)11-6-8-3-4-9(12(14)15)5-10(8)7-11/h3-5,11H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | UFVUDAGFZIJYRN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |