C25H33ClN2O — CID 142261137
5-[2-(2-chlorophenyl)ethyl-methylamino]-1-[2-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]pentan-1-one (PubChem CID 142261137) has the molecular formula C25H33ClN2O and a molecular weight of 413.01 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)ethyl-methylamino]-1-[2-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]pentan-1-one.
| Compound Name | 5-[2-(2-chlorophenyl)ethyl-methylamino]-1-[2-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]pentan-1-one |
|---|---|
| PubChem CID | 142261137 |
| Molecular Formula | C25H33ClN2O |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 5-[2-(2-chlorophenyl)ethyl-methylamino]-1-[2-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]pentan-1-one |
| SMILES | CN(CCCCC(=O)c1ccc2c(c1)CC(N(C)C)C2)CCc1ccccc1Cl |
| InChI | InChI=1S/C25H33ClN2O/c1-27(2)23-17-20-11-12-21(16-22(20)18-23)25(29)10-6-7-14-28(3)15-13-19-8-4-5-9-24(19)26/h4-5,8-9,11-12,16,23H,6-7,10,13-15,17-18H2,1-3H3 |
| InChIKey | OYZGWEJEOXRZFV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|