C27H36N2O2 — CID 515308
5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-fluoren-2-yl]pentan-1-one (PubChem CID 515308) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-fluoren-2-yl]pentan-1-one.
| Compound Name | 5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-fluoren-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 515308 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-fluoren-2-yl]pentan-1-one |
| SMILES | CN(C)CCCCC(=O)c1ccc2c(c1)Cc1cc(C(=O)CCCCN(C)C)ccc1-2 |
| InChI | InChI=1S/C27H36N2O2/c1-28(2)15-7-5-9-26(30)20-11-13-24-22(17-20)19-23-18-21(12-14-25(23)24)27(31)10-6-8-16-29(3)4/h11-14,17-18H,5-10,15-16,19H2,1-4H3 |
| InChIKey | DZZNWQDCOZGSMJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|