C27H37ClN2O6S — CID 58737339
tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[6-[3-(methanesulfonamido)-4-methoxyphenyl]-6-oxohexyl]carbamate (PubChem CID 58737339) has the molecular formula C27H37ClN2O6S and a molecular weight of 553.12 g/mol. Its IUPAC name is tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[6-[3-(methanesulfonamido)-4-methoxyphenyl]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[6-[3-(methanesulfonamido)-4-methoxyphenyl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 58737339 |
| Molecular Formula | C27H37ClN2O6S |
| Molecular Weight | 553.12 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-[6-[3-(methanesulfonamido)-4-methoxyphenyl]-6-oxohexyl]carbamate |
| SMILES | COc1ccc(C(=O)CCCCCN(CCc2ccccc2Cl)C(=O)OC(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C27H37ClN2O6S/c1-27(2,3)36-26(32)30(18-16-20-11-8-9-12-22(20)28)17-10-6-7-13-24(31)21-14-15-25(35-4)23(19-21)29-37(5,33)34/h8-9,11-12,14-15,19,29H,6-7,10,13,16-18H2,1-5H3 |
| InChIKey | ZOGMQUAONIWBCD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.12 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|