C28H38N2O6S — CID 142261001
tert-butyl N-[2-(2-methoxyphenyl)ethyl]-N-[5-oxo-5-(8-sulfinamoyl-3,4-dihydro-2H-chromen-6-yl)pentyl]carbamate (PubChem CID 142261001) has the molecular formula C28H38N2O6S and a molecular weight of 530.69 g/mol. Its IUPAC name is tert-butyl N-[2-(2-methoxyphenyl)ethyl]-N-[5-oxo-5-(8-sulfinamoyl-3,4-dihydro-2H-chromen-6-yl)pentyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-methoxyphenyl)ethyl]-N-[5-oxo-5-(8-sulfinamoyl-3,4-dihydro-2H-chromen-6-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 142261001 |
| Molecular Formula | C28H38N2O6S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | tert-butyl N-[2-(2-methoxyphenyl)ethyl]-N-[5-oxo-5-(8-sulfinamoyl-3,4-dihydro-2H-chromen-6-yl)pentyl]carbamate |
| SMILES | COc1ccccc1CCN(CCCCC(=O)c1cc2c(c(S(N)=O)c1)OCCC2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38N2O6S/c1-28(2,3)36-27(32)30(16-14-20-10-5-6-13-24(20)34-4)15-8-7-12-23(31)22-18-21-11-9-17-35-26(21)25(19-22)37(29)33/h5-6,10,13,18-19H,7-9,11-12,14-17,29H2,1-4H3 |
| InChIKey | GYSYRQJVRWUXBV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|