C23H27F3N2O3S — CID 143451554
6-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-2,3-dihydro-1H-indene-4-sulfinamide (PubChem CID 143451554) has the molecular formula C23H27F3N2O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is 6-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-2,3-dihydro-1H-indene-4-sulfinamide.
| Compound Name | 6-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-2,3-dihydro-1H-indene-4-sulfinamide |
|---|---|
| PubChem CID | 143451554 |
| Molecular Formula | C23H27F3N2O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 6-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-2,3-dihydro-1H-indene-4-sulfinamide |
| SMILES | NS(=O)c1cc(C(=O)CCCCNCCc2ccccc2OC(F)(F)F)cc2c1CCC2 |
| InChI | InChI=1S/C23H27F3N2O3S/c24-23(25,26)31-21-10-2-1-6-16(21)11-13-28-12-4-3-9-20(29)18-14-17-7-5-8-19(17)22(15-18)32(27)30/h1-2,6,10,14-15,28H,3-5,7-9,11-13,27H2 |
| InChIKey | PLHSHARVWDNXIV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|