C14H20ClF3N2O2 — CID 120502341
3-amino-2-methyl-N-[2-[2-(trifluoromethoxy)phenyl]ethyl]butanamide;hydrochloride (PubChem CID 120502341) has the molecular formula C14H20ClF3N2O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[2-[2-(trifluoromethoxy)phenyl]ethyl]butanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-[2-[2-(trifluoromethoxy)phenyl]ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120502341 |
| Molecular Formula | C14H20ClF3N2O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-amino-2-methyl-N-[2-[2-(trifluoromethoxy)phenyl]ethyl]butanamide;hydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCc1ccccc1OC(F)(F)F.Cl |
| InChI | InChI=1S/C14H19F3N2O2.ClH/c1-9(10(2)18)13(20)19-8-7-11-5-3-4-6-12(11)21-14(15,16)17;/h3-6,9-10H,7-8,18H2,1-2H3,(H,19,20);1H |
| InChIKey | QFFASZPXDCTVIP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |