C19H21F3N2O4 — CID 146131380
1-[2-hydroxy-1-(3-methoxyphenyl)ethyl]-3-[2-[2-(trifluoromethoxy)phenyl]ethyl]urea (PubChem CID 146131380) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(3-methoxyphenyl)ethyl]-3-[2-[2-(trifluoromethoxy)phenyl]ethyl]urea.
| Compound Name | 1-[2-hydroxy-1-(3-methoxyphenyl)ethyl]-3-[2-[2-(trifluoromethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 146131380 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-[2-hydroxy-1-(3-methoxyphenyl)ethyl]-3-[2-[2-(trifluoromethoxy)phenyl]ethyl]urea |
| SMILES | COc1cccc(C(CO)NC(=O)NCCc2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O4/c1-27-15-7-4-6-14(11-15)16(12-25)24-18(26)23-10-9-13-5-2-3-8-17(13)28-19(20,21)22/h2-8,11,16,25H,9-10,12H2,1H3,(H2,23,24,26) |
| InChIKey | SSGRSUVBDJEIMA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |