C15H20F3NO3 — CID 174497804
methyl 2-amino-4-methyl-6-[2-(trifluoromethoxy)phenyl]hexanoate (PubChem CID 174497804) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 2-amino-4-methyl-6-[2-(trifluoromethoxy)phenyl]hexanoate.
| Compound Name | methyl 2-amino-4-methyl-6-[2-(trifluoromethoxy)phenyl]hexanoate |
|---|---|
| PubChem CID | 174497804 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl 2-amino-4-methyl-6-[2-(trifluoromethoxy)phenyl]hexanoate |
| SMILES | COC(=O)C(N)CC(C)CCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H20F3NO3/c1-10(9-12(19)14(20)21-2)7-8-11-5-3-4-6-13(11)22-15(16,17)18/h3-6,10,12H,7-9,19H2,1-2H3 |
| InChIKey | FLSZTMLVFYYASV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |