C16H19F6NO2 — CID 174498077
methyl 2-amino-6-[2,6-bis(trifluoromethyl)phenyl]-4-methylhexanoate (PubChem CID 174498077) has the molecular formula C16H19F6NO2 and a molecular weight of 371.32 g/mol. Its IUPAC name is methyl 2-amino-6-[2,6-bis(trifluoromethyl)phenyl]-4-methylhexanoate.
| Compound Name | methyl 2-amino-6-[2,6-bis(trifluoromethyl)phenyl]-4-methylhexanoate |
|---|---|
| PubChem CID | 174498077 |
| Molecular Formula | C16H19F6NO2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | methyl 2-amino-6-[2,6-bis(trifluoromethyl)phenyl]-4-methylhexanoate |
| SMILES | COC(=O)C(N)CC(C)CCc1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F6NO2/c1-9(8-13(23)14(24)25-2)6-7-10-11(15(17,18)19)4-3-5-12(10)16(20,21)22/h3-5,9,13H,6-8,23H2,1-2H3 |
| InChIKey | RWVCIUMUPIQVBG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |