C17H21F6NO2 — CID 174497937
methyl 2-amino-6-[2,4-bis(trifluoromethyl)phenyl]-4-ethylhexanoate (PubChem CID 174497937) has the molecular formula C17H21F6NO2 and a molecular weight of 385.35 g/mol. Its IUPAC name is methyl 2-amino-6-[2,4-bis(trifluoromethyl)phenyl]-4-ethylhexanoate.
| Compound Name | methyl 2-amino-6-[2,4-bis(trifluoromethyl)phenyl]-4-ethylhexanoate |
|---|---|
| PubChem CID | 174497937 |
| Molecular Formula | C17H21F6NO2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 2-amino-6-[2,4-bis(trifluoromethyl)phenyl]-4-ethylhexanoate |
| SMILES | CCC(CCc1ccc(C(F)(F)F)cc1C(F)(F)F)CC(N)C(=O)OC |
| InChI | InChI=1S/C17H21F6NO2/c1-3-10(8-14(24)15(25)26-2)4-5-11-6-7-12(16(18,19)20)9-13(11)17(21,22)23/h6-7,9-10,14H,3-5,8,24H2,1-2H3 |
| InChIKey | WBRDJQJBWQRCCC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |