C17H25F3N2O2 — CID 119660284
N-(3-amino-4-methylpentyl)-N-methyl-3-[2-(trifluoromethoxy)phenyl]propanamide (PubChem CID 119660284) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-3-[2-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-3-[2-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 119660284 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-3-[2-(trifluoromethoxy)phenyl]propanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H25F3N2O2/c1-12(2)14(21)10-11-22(3)16(23)9-8-13-6-4-5-7-15(13)24-17(18,19)20/h4-7,12,14H,8-11,21H2,1-3H3 |
| InChIKey | QROPGRTXDVRTES-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |