C28H33ClN2O8 — CID 162338347
6-[5-[2-(2-chlorophenyl)ethylamino]pentanoyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 162338347) has the molecular formula C28H33ClN2O8 and a molecular weight of 561.03 g/mol. Its IUPAC name is 6-[5-[2-(2-chlorophenyl)ethylamino]pentanoyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | 6-[5-[2-(2-chlorophenyl)ethylamino]pentanoyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 162338347 |
| Molecular Formula | C28H33ClN2O8 |
| Molecular Weight | 561.03 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 6-[5-[2-(2-chlorophenyl)ethylamino]pentanoyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | O=C(CCCCNCCc1ccccc1Cl)c1cc2c3c(c1)CC(=O)N3CCC2.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C24H27ClN2O2.C4H6O6/c25-21-8-2-1-6-17(21)10-12-26-11-4-3-9-22(28)19-14-18-7-5-13-27-23(29)16-20(15-19)24(18)27;5-1(3(7)8)2(6)4(9)10/h1-2,6,8,14-15,26H,3-5,7,9-13,16H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | FHOKZDOJBHJDQL-LREBCSMRSA-N |
| XLogP | 2.24 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.03 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|