C21H28ClN3O3S — CID 69232349
5-[2-(2-chlorophenyl)ethylamino]-1-(2,2-dihydroxy-1,3-dimethyl-2λ4,1,3-benzothiadiazol-5-yl)pentan-1-one (PubChem CID 69232349) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)ethylamino]-1-(2,2-dihydroxy-1,3-dimethyl-2λ4,1,3-benzothiadiazol-5-yl)pentan-1-one.
| Compound Name | 5-[2-(2-chlorophenyl)ethylamino]-1-(2,2-dihydroxy-1,3-dimethyl-2λ4,1,3-benzothiadiazol-5-yl)pentan-1-one |
|---|---|
| PubChem CID | 69232349 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-[2-(2-chlorophenyl)ethylamino]-1-(2,2-dihydroxy-1,3-dimethyl-2λ4,1,3-benzothiadiazol-5-yl)pentan-1-one |
| SMILES | CN1c2ccc(C(=O)CCCCNCCc3ccccc3Cl)cc2N(C)S1(O)O |
| InChI | InChI=1S/C21H28ClN3O3S/c1-24-19-11-10-17(15-20(19)25(2)29(24,27)28)21(26)9-5-6-13-23-14-12-16-7-3-4-8-18(16)22/h3-4,7-8,10-11,15,23,27-28H,5-6,9,12-14H2,1-2H3 |
| InChIKey | QPTDEKPAWPWXEV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|