C19H23NO4S — CID 69220675
2-(2-methoxyphenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid (PubChem CID 69220675) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid.
| Compound Name | 2-(2-methoxyphenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid |
|---|---|
| PubChem CID | 69220675 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-(2-methoxyphenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid |
| SMILES | COc1ccccc1CCN(CCCCC(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C19H23NO4S/c1-24-17-9-3-2-7-15(17)11-13-20(19(22)23)12-5-4-8-16(21)18-10-6-14-25-18/h2-3,6-7,9-10,14H,4-5,8,11-13H2,1H3,(H,22,23) |
| InChIKey | SOFZXOZPKZDVBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|