C25H31N3O5 — CID 69220606
[5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl]-[3-(2-methoxyphenyl)propyl]carbamic acid (PubChem CID 69220606) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is [5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl]-[3-(2-methoxyphenyl)propyl]carbamic acid.
| Compound Name | [5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl]-[3-(2-methoxyphenyl)propyl]carbamic acid |
|---|---|
| PubChem CID | 69220606 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-oxopentyl]-[3-(2-methoxyphenyl)propyl]carbamic acid |
| SMILES | COc1ccccc1CCCN(CCCCC(=O)c1ccc2c(c1)n(C)c(=O)n2C)C(=O)O |
| InChI | InChI=1S/C25H31N3O5/c1-26-20-14-13-19(17-21(20)27(2)24(26)30)22(29)11-6-7-15-28(25(31)32)16-8-10-18-9-4-5-12-23(18)33-3/h4-5,9,12-14,17H,6-8,10-11,15-16H2,1-3H3,(H,31,32) |
| InChIKey | TWPLOMTTXLWKFL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|