C25H34N2O7S — CID 69217513
2-(2-methoxyphenyl)ethyl-[5-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]-5-oxopentyl]carbamic acid (PubChem CID 69217513) has the molecular formula C25H34N2O7S and a molecular weight of 506.62 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)ethyl-[5-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]-5-oxopentyl]carbamic acid.
| Compound Name | 2-(2-methoxyphenyl)ethyl-[5-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]-5-oxopentyl]carbamic acid |
|---|---|
| PubChem CID | 69217513 |
| Molecular Formula | C25H34N2O7S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2-(2-methoxyphenyl)ethyl-[5-[4-methoxy-3-(propan-2-ylsulfamoyl)phenyl]-5-oxopentyl]carbamic acid |
| SMILES | COc1ccccc1CCN(CCCCC(=O)c1ccc(OC)c(S(=O)(=O)NC(C)C)c1)C(=O)O |
| InChI | InChI=1S/C25H34N2O7S/c1-18(2)26-35(31,32)24-17-20(12-13-23(24)34-4)21(28)10-7-8-15-27(25(29)30)16-14-19-9-5-6-11-22(19)33-3/h5-6,9,11-13,17-18,26H,7-8,10,14-16H2,1-4H3,(H,29,30) |
| InChIKey | JULILMVTOSTMFB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|