C18H20ClNO3S — CID 69220427
2-(2-chlorophenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid (PubChem CID 69220427) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid.
| Compound Name | 2-(2-chlorophenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid |
|---|---|
| PubChem CID | 69220427 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl-(5-oxo-5-thiophen-2-ylpentyl)carbamic acid |
| SMILES | O=C(CCCCN(CCc1ccccc1Cl)C(=O)O)c1cccs1 |
| InChI | InChI=1S/C18H20ClNO3S/c19-15-7-2-1-6-14(15)10-12-20(18(22)23)11-4-3-8-16(21)17-9-5-13-24-17/h1-2,5-7,9,13H,3-4,8,10-12H2,(H,22,23) |
| InChIKey | MOWOXMFNUXDCTF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|