C18H26ClNO3S — CID 87209327
2-(2-chlorophenyl)ethyl-[4,4-dimethyl-3-(2-oxoethylsulfanyl)pentyl]carbamic acid (PubChem CID 87209327) has the molecular formula C18H26ClNO3S and a molecular weight of 371.93 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl-[4,4-dimethyl-3-(2-oxoethylsulfanyl)pentyl]carbamic acid.
| Compound Name | 2-(2-chlorophenyl)ethyl-[4,4-dimethyl-3-(2-oxoethylsulfanyl)pentyl]carbamic acid |
|---|---|
| PubChem CID | 87209327 |
| Molecular Formula | C18H26ClNO3S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl-[4,4-dimethyl-3-(2-oxoethylsulfanyl)pentyl]carbamic acid |
| SMILES | CC(C)(C)C(CCN(CCc1ccccc1Cl)C(=O)O)SCC=O |
| InChI | InChI=1S/C18H26ClNO3S/c1-18(2,3)16(24-13-12-21)9-11-20(17(22)23)10-8-14-6-4-5-7-15(14)19/h4-7,12,16H,8-11,13H2,1-3H3,(H,22,23) |
| InChIKey | VELWJGAWGJNSDX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|