C18H26ClNO3S — CID 90950449
[4-(2-chlorophenyl)-1-(3-oxopropylsulfanyl)butan-2-yl] N-tert-butylcarbamate (PubChem CID 90950449) has the molecular formula C18H26ClNO3S and a molecular weight of 371.93 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-1-(3-oxopropylsulfanyl)butan-2-yl] N-tert-butylcarbamate.
| Compound Name | [4-(2-chlorophenyl)-1-(3-oxopropylsulfanyl)butan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90950449 |
| Molecular Formula | C18H26ClNO3S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [4-(2-chlorophenyl)-1-(3-oxopropylsulfanyl)butan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(CCc1ccccc1Cl)CSCCC=O |
| InChI | InChI=1S/C18H26ClNO3S/c1-18(2,3)20-17(22)23-15(13-24-12-6-11-21)10-9-14-7-4-5-8-16(14)19/h4-5,7-8,11,15H,6,9-10,12-13H2,1-3H3,(H,20,22) |
| InChIKey | ACLIVFWORVACSA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|