C14H19ClN2O3 — CID 95767278
(2R)-2-[3-(2-chlorophenyl)propanoylamino]-3-methoxy-2-methylpropanamide (PubChem CID 95767278) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is (2R)-2-[3-(2-chlorophenyl)propanoylamino]-3-methoxy-2-methylpropanamide.
| Compound Name | (2R)-2-[3-(2-chlorophenyl)propanoylamino]-3-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 95767278 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2R)-2-[3-(2-chlorophenyl)propanoylamino]-3-methoxy-2-methylpropanamide |
| SMILES | COC[C@@](C)(NC(=O)CCc1ccccc1Cl)C(N)=O |
| InChI | InChI=1S/C14H19ClN2O3/c1-14(9-20-2,13(16)19)17-12(18)8-7-10-5-3-4-6-11(10)15/h3-6H,7-9H2,1-2H3,(H2,16,19)(H,17,18)/t14-/m1/s1 |
| InChIKey | XJLFIPBKWMQNDO-CQSZACIVSA-N |
| XLogP | 1.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |