About 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol
2-(2-chlorophenyl)ethyl carbamate;methoxymethanol (PubChem CID 144705844) has the molecular formula C11H16ClNO4
and a molecular weight of 261.70 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol |
| PubChem CID | 144705844 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol |
| SMILES | COCO.NC(=O)OCCc1ccccc1Cl |
| InChI | InChI=1S/C9H10ClNO2.C2H6O2/c10-8-4-2-1-3-7(8)5-6-13-9(11)12;1-4-2-3/h1-4H,5-6H2,(H2,11,12);3H,2H2,1H3 |
| InChIKey | FHXFEBVYAAXHLI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol?
The IUPAC name of 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol (CID 144705844) is 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol.
What is the SMILES notation for 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol?
The canonical SMILES for 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol is COCO.NC(=O)OCCc1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol?
The InChIKey is FHXFEBVYAAXHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2.C2H6O2/c10-8-4-2-1-3-7(8)5-6-13-9(11)12;1-4-2-3/h1-4H,5-6H2,(H2,11,12);3H,2H2,1H3.
What are the key properties of 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol?
2-(2-chlorophenyl)ethyl carbamate;methoxymethanol has a molecular weight of 261.70 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)ethyl carbamate;methoxymethanol is sourced from PubChem (CID 144705844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).