C14H19ClO4 — CID 144861679
methyl (2S)-4-(2-chlorophenyl)-2-(2-hydroxypropan-2-yloxy)butanoate (PubChem CID 144861679) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is methyl (2S)-4-(2-chlorophenyl)-2-(2-hydroxypropan-2-yloxy)butanoate.
| Compound Name | methyl (2S)-4-(2-chlorophenyl)-2-(2-hydroxypropan-2-yloxy)butanoate |
|---|---|
| PubChem CID | 144861679 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl (2S)-4-(2-chlorophenyl)-2-(2-hydroxypropan-2-yloxy)butanoate |
| SMILES | COC(=O)[C@H](CCc1ccccc1Cl)OC(C)(C)O |
| InChI | InChI=1S/C14H19ClO4/c1-14(2,17)19-12(13(16)18-3)9-8-10-6-4-5-7-11(10)15/h4-7,12,17H,8-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | NBMZGQISJFPYPW-LBPRGKRZSA-N |
| XLogP | 2.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|