C17H24O4 — CID 144861759
methyl (2R)-2-(1-hydroxycyclopentyl)oxy-4-(2-methylphenyl)butanoate (PubChem CID 144861759) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (2R)-2-(1-hydroxycyclopentyl)oxy-4-(2-methylphenyl)butanoate.
| Compound Name | methyl (2R)-2-(1-hydroxycyclopentyl)oxy-4-(2-methylphenyl)butanoate |
|---|---|
| PubChem CID | 144861759 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl (2R)-2-(1-hydroxycyclopentyl)oxy-4-(2-methylphenyl)butanoate |
| SMILES | COC(=O)[C@@H](CCc1ccccc1C)OC1(O)CCCC1 |
| InChI | InChI=1S/C17H24O4/c1-13-7-3-4-8-14(13)9-10-15(16(18)20-2)21-17(19)11-5-6-12-17/h3-4,7-8,15,19H,5-6,9-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | JPPOJQROFRBAIM-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|