C17H24O4 — CID 144861695
methyl (2S,3S)-3-(1-hydroxycyclopentyl)oxy-2-methyl-3-(2-methylphenyl)propanoate (PubChem CID 144861695) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (2S,3S)-3-(1-hydroxycyclopentyl)oxy-2-methyl-3-(2-methylphenyl)propanoate.
| Compound Name | methyl (2S,3S)-3-(1-hydroxycyclopentyl)oxy-2-methyl-3-(2-methylphenyl)propanoate |
|---|---|
| PubChem CID | 144861695 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl (2S,3S)-3-(1-hydroxycyclopentyl)oxy-2-methyl-3-(2-methylphenyl)propanoate |
| SMILES | COC(=O)[C@@H](C)[C@H](OC1(O)CCCC1)c1ccccc1C |
| InChI | InChI=1S/C17H24O4/c1-12-8-4-5-9-14(12)15(13(2)16(18)20-3)21-17(19)10-6-7-11-17/h4-5,8-9,13,15,19H,6-7,10-11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | JLRFONBDZSQFEP-ZFWWWQNUSA-N |
| XLogP | 3.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|