About (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane
(Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane (PubChem CID 143386207) has the molecular formula C20H26BrClN2O
and a molecular weight of 425.80 g/mol. Its IUPAC name is (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane.
Molecular Properties
| Compound Name | (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane |
| PubChem CID | 143386207 |
| Molecular Formula | C20H26BrClN2O |
| Molecular Weight | 425.80 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane |
| SMILES | CBr.CC(C)(O)/C(N)=C/N(CCc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H23ClN2O.CH3Br/c1-19(2,23)18(21)14-22(16-9-4-3-5-10-16)13-12-15-8-6-7-11-17(15)20;1-2/h3-11,14,23H,12-13,21H2,1-2H3;1H3/b18-14-; |
| InChIKey | VJRXPUYRSOQHKZ-NYAKATHWSA-N |
| XLogP | 4.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.80 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane?
The IUPAC name of (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane (CID 143386207) is (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane.
What is the SMILES notation for (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane?
The canonical SMILES for (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane is CBr.CC(C)(O)/C(N)=C/N(CCc1ccccc1Cl)c1ccccc1.
What is the InChIKey of (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane?
The InChIKey is VJRXPUYRSOQHKZ-NYAKATHWSA-N. The full InChI is InChI=1S/C19H23ClN2O.CH3Br/c1-19(2,23)18(21)14-22(16-9-4-3-5-10-16)13-12-15-8-6-7-11-17(15)20;1-2/h3-11,14,23H,12-13,21H2,1-2H3;1H3/b18-14-;.
What are the key properties of (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane?
(Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane has a molecular weight of 425.80 g/mol, XLogP of 4.97, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-4-[N-[2-(2-chlorophenyl)ethyl]anilino]-2-methylbut-3-en-2-ol;bromomethane is sourced from PubChem (CID 143386207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).