C14H19Cl2NO3S — CID 69076678
2-(2,3-dichlorophenyl)ethyl-[2-(3-hydroxypropylsulfanyl)ethyl]carbamic acid (PubChem CID 69076678) has the molecular formula C14H19Cl2NO3S and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)ethyl-[2-(3-hydroxypropylsulfanyl)ethyl]carbamic acid.
| Compound Name | 2-(2,3-dichlorophenyl)ethyl-[2-(3-hydroxypropylsulfanyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 69076678 |
| Molecular Formula | C14H19Cl2NO3S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)ethyl-[2-(3-hydroxypropylsulfanyl)ethyl]carbamic acid |
| SMILES | O=C(O)N(CCSCCCO)CCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H19Cl2NO3S/c15-12-4-1-3-11(13(12)16)5-6-17(14(19)20)7-10-21-9-2-8-18/h1,3-4,18H,2,5-10H2,(H,19,20) |
| InChIKey | LZPTVRDBDMZTHO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|