C23H26Cl4O — CID 70291531
1,11-bis(2,3-dichlorophenyl)undecan-6-one (PubChem CID 70291531) has the molecular formula C23H26Cl4O and a molecular weight of 460.27 g/mol. Its IUPAC name is 1,11-bis(2,3-dichlorophenyl)undecan-6-one.
| Compound Name | 1,11-bis(2,3-dichlorophenyl)undecan-6-one |
|---|---|
| PubChem CID | 70291531 |
| Molecular Formula | C23H26Cl4O |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 1,11-bis(2,3-dichlorophenyl)undecan-6-one |
| SMILES | O=C(CCCCCc1cccc(Cl)c1Cl)CCCCCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H26Cl4O/c24-20-15-7-11-17(22(20)26)9-3-1-5-13-19(28)14-6-2-4-10-18-12-8-16-21(25)23(18)27/h7-8,11-12,15-16H,1-6,9-10,13-14H2 |
| InChIKey | GEKLXXAWMYNRID-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|