C16H24ClNO2 — CID 155707646
N-[2-chloro-3-(4-oxohexyl)phenyl]acetamide;ethane (PubChem CID 155707646) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[2-chloro-3-(4-oxohexyl)phenyl]acetamide;ethane.
| Compound Name | N-[2-chloro-3-(4-oxohexyl)phenyl]acetamide;ethane |
|---|---|
| PubChem CID | 155707646 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[2-chloro-3-(4-oxohexyl)phenyl]acetamide;ethane |
| SMILES | CC.CCC(=O)CCCc1cccc(NC(C)=O)c1Cl |
| InChI | InChI=1S/C14H18ClNO2.C2H6/c1-3-12(18)8-4-6-11-7-5-9-13(14(11)15)16-10(2)17;1-2/h5,7,9H,3-4,6,8H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | YOGCXJLYUFNLKL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |